|
|
| | 2-(4-Hydroxybenzoyl)benzoic acid Basic information |
| | 2-(4-Hydroxybenzoyl)benzoic acid Chemical Properties |
| Melting point | 213 °C | | Boiling point | 512.6±35.0 °C(Predicted) | | density | 1.356±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.35±0.36(Predicted) | | form | Powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H10O4/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8,15H,(H,17,18) | | InChIKey | YGTUPRIZNBMOFV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(O)C=C1 | | CAS DataBase Reference | 85-57-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-(4-Hydroxybenzoyl)benzoic acid (85-57-4) |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 2-(4-Hydroxybenzoyl)benzoic acid Usage And Synthesis |
| Description | 2-(4-Hydroxybenzoyl)benzoic acid is a white crystalline powder. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. The compound has a melting point range of approximately 245-250 ℃. The synthesis of 2-(4-Hydroxybenzoyl)benzoic acid involves the reaction of 4-hydroxybenzoic acid (also known as p-hydroxybenzoic acid) with benzoyl chloride or benzoyl anhydride. The reaction occurs through an acylation process where the benzoyl group is added to the benzene ring of the 4-hydroxybenzoic acid. This compound has potential applications in various fields, including pharmaceuticals and materials science. It can serve as a building block for synthesising other organic compounds or as a starting material for preparing pharmaceutical intermediates. Additionally, it may exhibit certain properties that make it useful in developing materials or coatings. |
| | 2-(4-Hydroxybenzoyl)benzoic acid Preparation Products And Raw materials |
|