|
|
| | (-)-(6-Propylamino)-5,6,7,8-tetrahydro-naphthalen-1-ol Basic information |
| Product Name: | (-)-(6-Propylamino)-5,6,7,8-tetrahydro-naphthalen-1-ol | | Synonyms: | (6S)-5,6,7,8-Tetrahydro-6-(propylamino)-1-naphthalenol;(-)-5-Hydroxy-N-n-propyl-2-aMinotetralin;(S)-(-)-5-Hydroxy-N-n-propyl-2-aMinotetralin;(S)-5,6,7,8-Tetrahydro-6-propylaMino-1-naphthalenol;Desthienyl-Rotigotine;Desthienylethyl Rotigotine;1-Naphthalenol, 5,6,7,8-tetrahydro-6-(propylamino)-, (6S)-;Rotigotine EP Impurity B | | CAS: | 101470-23-9 | | MF: | C13H19NO | | MW: | 205.3 | | EINECS: | | | Product Categories: | Amines;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 101470-23-9.mol |  |
| | (-)-(6-Propylamino)-5,6,7,8-tetrahydro-naphthalen-1-ol Chemical Properties |
| Boiling point | 341.5±42.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.96±0.20(Predicted) | | InChI | 1S/C13H19NO/c1-2-8-14-11-6-7-12-10(9-11)4-3-5-13(12)15/h3-5,11,14-15H,2,6-9H2,1H3/t11-/m0/s1 | | InChIKey | VCYPZWCFSAHTQT-NSHDSACASA-N | | SMILES | N([C@H]1CCc2c(cccc2O)C1)CCC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (-)-(6-Propylamino)-5,6,7,8-tetrahydro-naphthalen-1-ol Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A substituted tetralin used in the production of antiparkinson medications | | Uses | As a substituted tetralin, (6S)-5,6,7,8-Tetrahydro-6-(propylaMino)-1-naphthalenol is used in the production of antiparkinson medications |
| | (-)-(6-Propylamino)-5,6,7,8-tetrahydro-naphthalen-1-ol Preparation Products And Raw materials |
|