| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:1H-1,2,4-Triazole-1-ethanol,b-[(2,4-dichlorophenyl)methyl]-a-(1,1-dimethylethyl)-, (aR,bR)-rel-
CAS:75736-33-3
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
- diclobutrazol
-
- $1.00
-
2020-02-05
- CAS:75736-33-3
- Min. Order: 1KG
- Purity: Min98% HPLC
|
| | Diclobutrazol Basic information |
| Product Name: | Diclobutrazol | | Synonyms: | vigilex;(r*,r*)-(+-)-beta-[(2,4-dichlorophenyl)methyl]-alpha-(1,1-dimethylethyl)-1h-1,2,4-triazole-1-ethanol;VIGIL;DICHLOBUTRAZOL;DICLOBUTRAZOL;E-(R,S)-1-(2,4-DICHLOROPHENYL)-4,4-DIMETHYL-2-(1H-1,2,4-TRIAZOL-1-YL)PENT-1-ENE-3-OL;DICLOBUTRAZOL MIXTURE OF STEREO ISOMERS,;1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol | | CAS: | 75736-33-3 | | MF: | C15H19Cl2N3O | | MW: | 328.24 | | EINECS: | | | Product Categories: | Alpha sort;ConazolesPesticides&Metabolites;D;DAlphabetic;DIA - DIC;Fungicides;Pesticides | | Mol File: | 75736-33-3.mol |  |
| | Diclobutrazol Chemical Properties |
| Melting point | 147-149° | | Boiling point | 484.3±55.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | Fp | >100 °C | | storage temp. | 0-6°C | | form | Solid | | pka | 13.86±0.20(Predicted) | | color | White to off-white | | Merck | 13,3107 | | Henry's Law Constant | 8.0×103 mol/(m3Pa) at 25℃, MacBean (2012) | | Major Application | agriculture
environmental | | InChI | 1S/C15H19Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-5,7-9,13-14,21H,6H2,1-3H3 | | InChIKey | URDNHJIVMYZFRT-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(O)C(Cc1ccc(Cl)cc1Cl)n2cncn2 | | NIST Chemistry Reference | 1H-1,2,4-triazole-1-ethanol, «beta»-((2,4-dichlorophenyl)methyl)-«alpha»-(1,1-dimethylethyl)-,(r*,r*)-(.+/-.)-(75736-33-3) | | EPA Substance Registry System | 1H-1,2,4-Triazole-1-ethanol, .beta.-[(2,4-dichlorophenyl)methyl]-.alpha.-(1,1-dimethylethyl)-, (.alpha.R,.beta.R)-rel- (75736-33-3) |
| Hazard Codes | Xi;N,N,Xi | | Risk Statements | 36-51/53 | | Safety Statements | 26-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | RTECS | XZ4804000 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2 | | Toxicity | LD50 in rats (mg/kg): ~4000 orally; >1000 dermally; in mallard ducks: >9000 orally (Bent, Skidmore) |
| | Diclobutrazol Usage And Synthesis |
| Chemical Properties | Diclobutrazol is a white crystal. Soluble in acetone, chlorine, methanol, ethanol and other organic solvents; slightly soluble in water, the solubility in water is 9mg/L. It is stable to acid, alkali, light and heat. Under the condition of strong acid and alkali, the hydrolysis half-life is 5d at 80℃. Under the condition of pH value of 4~9, its aqueous solution is stable to natural light for more than 33d. At 50℃, 37℃ Under the conditions, the stability of the original drug is above 90d and 182d, respectively. | | Uses | Diclobutrazol, a systemic fungicide, is highly active against rusts, powdery mildews, and other fungal phytopathogens. Diclobutrazol can be used as a pesticide to control of various crop diseases, such as powdery mildew, smut of wheat, sheath blight of rice, etc. | | Definition | ChEBI: Diclobutrazol is a conazole fungicide and a triazole fungicide. |
| | Diclobutrazol Preparation Products And Raw materials |
|