|
|
| | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Basic information |
| | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Chemical Properties |
| storage temp. | Store at 0-8 °C | | form | solid | | Appearance | off-white solid | | InChI | 1S/C8H4F3IN2/c9-8(10,11)4-1-5-6(12)3-14-7(5)13-2-4/h1-3H,(H,13,14) | | InChIKey | NSRVALWCFIYTLR-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cnc2[nH]cc(I)c2c1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Usage And Synthesis |
| Uses | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is used as a reactant in the preparation of azaindole derivatives as kinase modulators. |
| | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine Preparation Products And Raw materials |
|