|
|
| | Methyl 5-chloro-2-methoxynicotinate Basic information |
| Product Name: | Methyl 5-chloro-2-methoxynicotinate | | Synonyms: | Methyl 5-chloro-2-methoxynicotinate;Methyl 5-chloro-2-methoxy-3-pyridinecarboxylate;Methyl 5-chloro-2-methoxypyridine-3-carboxylate, 5-Chloro-2-methoxy-3-(methoxycarbonyl)pyridine;Methyl 5-chloro-2-Methoxypyridine-3-carboxylate;5-Chloro-2-Methoxy-nicotinic acid Methyl ester;5-Chloro-2-Methoxy-3-pyridinecarboxylic acid Methyl ester;3-Pyridinecarboxylic acid, 5-chloro-2-Methoxy-, Methyl ester;5-chloro-2-methoxyacidmethyl ester | | CAS: | 82060-51-3 | | MF: | C8H8ClNO3 | | MW: | 201.61 | | EINECS: | | | Product Categories: | | | Mol File: | 82060-51-3.mol |  |
| | Methyl 5-chloro-2-methoxynicotinate Chemical Properties |
| Melting point | 79-81 °C | | Boiling point | 261℃ | | density | 1.288 | | Fp | 111℃ | | storage temp. | 2-8°C | | pka | -0.92±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8ClNO3/c1-12-7-6(8(11)13-2)3-5(9)4-10-7/h3-4H,1-2H3 | | InChIKey | KHGQMIBDLPEOCL-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=C(Cl)C=C1C(OC)=O |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | Methyl 5-chloro-2-methoxynicotinate Usage And Synthesis |
| | Methyl 5-chloro-2-methoxynicotinate Preparation Products And Raw materials |
|