| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine Basic information |
| | 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine Chemical Properties |
| form | solid | | InChI | 1S/C10H12BrNOSi/c1-14(2,3)10-5-8-9(13-10)4-7(11)6-12-8/h4-6H,1-3H3 | | InChIKey | IXYOZGPZWPDQKP-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)c1cc2ncc(Br)cc2o1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine Usage And Synthesis |
| | 6-Bromo-2-(trimethylsilyl)furo[3,2-b]pyridine Preparation Products And Raw materials |
|