| Company Name: |
Ascent Scientific |
| Tel: |
4401179829988 |
| Email: |
customerservice@ascentscientific.co.uk |
|
| | 7-Chlorokynurenic acid sodium salt Basic information |
| Product Name: | 7-Chlorokynurenic acid sodium salt | | Synonyms: | 7-Chlorokynurenic acid sodium salt;7-Chloro-4-hydroxyquinoline-2-carboxylicacidsodiumsalt;7-CKA sodium salt;7Chlorokynurenic acid sodium salt,7 Chlorokynurenic acid sodium salt;7-Chlorokynurenic acid sodium salt (mM/ml), NMDA receptor glycine site antagonist;7-Chlorokynurenic acid sodium salt (Aqueous Solution);7-Chlorokynurenic acid sodium salt, NMDA receptor glycine site antagonist | | CAS: | 1263094-00-3 | | MF: | C10H7ClNNaO3 | | MW: | 247.61 | | EINECS: | | | Product Categories: | Glutamate | | Mol File: | 1263094-00-3.mol |  |
| | 7-Chlorokynurenic acid sodium salt Chemical Properties |
| storage temp. | Desiccate at RT | | solubility | water: 100 mM | | form | Powder | | color | White to off-white | | Water Solubility | Soluble in water at 100mM | | InChI | 1S/C10H6ClNO3.Na/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13;/h1-4H,(H,12,13)(H,14,15);/q;+1/p-1 | | InChIKey | IFZYIORLNGNLEI-UHFFFAOYSA-M | | SMILES | [Na+].Clc1cc2[nH]c(c[c](c2cc1)=O)C(=O)[O-] |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 7-Chlorokynurenic acid sodium salt Usage And Synthesis |
| Uses | 7-Chlorokynurenic acid sodium salt is used as a Potent competitive inhibitor of L-glutamate transport into synaptic vesicles. It is also used as an NMDA receptor antagonist and inhibitor of EAAT. | | Biological Activity | Primary Target
NMDA receptors | | in vivo | Male Sprague-Dawley rats pretreated with 7-Chlorokynurenic acid sodium salt (10 nM) shows a significant retardation of development of both the electroencephalographic and motor (17.7±2.9 daily stimulations) components of the seizure response[3]. | | IC 50 | NMDA Receptor | | storage | Desiccate at RT |
| | 7-Chlorokynurenic acid sodium salt Preparation Products And Raw materials |
|