|
|
| | 6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE Basic information |
| Product Name: | 6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE | | Synonyms: | 6-Bromocarbostiryl;6-BroMo-3,4-dihydro-(1H)-2-quinolinone;6-BroMo-3,4-dihydrocarbostyril;6-Bromo-2-oxo-1,2,3,4-tetrahydroquinoline;6-BROMO-1,2,3,4-TETRAHYDRO-2-QUINOLINONE;6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE;6-BROMO-3,4-DIHYDRO-2(1H)-QUINOLINONE;6-BROMO-3,4-DIHYDROQUINOLIN-2(1H)-ONE | | CAS: | 3279-90-1 | | MF: | C9H8BrNO | | MW: | 226.07 | | EINECS: | | | Product Categories: | | | Mol File: | 3279-90-1.mol |  |
| | 6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE Chemical Properties |
| Melting point | 170-172℃ | | Boiling point | 376.3±42.0 °C(Predicted) | | density | 1.559±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | pka | 13.92±0.20(Predicted) | | color | Brown | | Sensitive | Light Sensitive | | InChI | InChI=1S/C9H8BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h2-3,5H,1,4H2,(H,11,12) | | InChIKey | MQWZSSIUHXNNTM-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C=C2)CCC1=O | | CAS DataBase Reference | 3279-90-1(CAS DataBase Reference) |
| | 6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE Usage And Synthesis |
| Synthesis | 3,4-Dihydroquinolin-2(1H)-one (2.73 g, 18.55 mmol) was dissolved in N,N-dimethylacetamide (30 mL) and N,N-dimethylacetamide (10 mL) solution of N-bromosuccinimide (3.30 g, 18.55 mmol) was added slowly and dropwise in an ice water bath. The reaction solution continued to react in an ice water bath with stirring for 6 hours and then warmed up to room temperature for 12 hours. At the end of the reaction, water (50 mL) was added to the reaction mixture and extracted with ethyl acetate (50 mL x 3). The organic phases were combined, dried with anhydrous sodium sulfate, filtered, and concentrated under reduced pressure, and the resulting residue was purified by silica gel column chromatography (petroleum ether/ethyl acetate (v/v) = 3/1) to afford the title compound as a white solid (3.86 g, 92.1%). |
| | 6-BROMO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE Preparation Products And Raw materials |
|