- alpha-D-glucose
-
- $107.00 / 500mg
-
2026-02-26
- CAS:492-62-6
- Min. Order:
- Purity: 99.87%
- Supply Ability: 10g
- DEXTROSE
-
- $1.00 / 1KG
-
2025-12-12
- CAS:492-62-6
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 200000KG
- α-D-(+)-Glucose
-
- $0.00 / 1KG
-
2020-05-04
- CAS:492-62-6
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 600 Tons
|
| | DEXTROSE Basic information |
| | DEXTROSE Chemical Properties |
| Melting point | 153-156 °C(lit.) | | Boiling point | 232.96°C (rough estimate) | | density | 1.544g/cm3 | | refractive index | n20/D 1.362 | | storage temp. | Sealed in dry,Room Temperature | | solubility | H2O: 1 M at 20 °C, clear, colorless | | pka | 12.12±0.70(Predicted) | | form | solution | | color | White | | PH | 5.0-8.0 (25℃) | | Odor | odorless | | Optical Rotation | [α]20/D +52°, c = 10 in H2O | | Water Solubility | 450.5g/L(25 ºC) | | λmax | λ: 260 nm Amax: 0.04 λ: 280 nm Amax: 0.04 | | BRN | 1281608 | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 | | InChIKey | WQZGKKKJIJFFOK-DVKNGEFBSA-N | | SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O | | LogP | -1.880 (est) | | CAS DataBase Reference | 492-62-6(CAS DataBase Reference) | | CAS Number Unlabeled | 50-99-7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | RTECS | LZ6600000 | | F | 3 | | HS Code | 17023000 | | Storage Class | 11 - Combustible Solids |
| | DEXTROSE Usage And Synthesis |
| Chemical Properties | white, odorless, fine crystalline powder | | Uses | α-D-Glucose is used:
- As a reducing agent in the preparation superparamagnetic ferrous oxide (Fe3O4) nanoparticles and silver nanocrystals.
- As an additive for the formation of isoporous polystyrene-block-poly(4-vinylpyridine) (PS-b-P4VP) diblock copolymer membranes.
- For glycosylation of cell-penetrating poly(disulfide)s (CPDs) with improved solubility to achieve multifunctional cellular uptake.
- As a precursor in the synthesis of metal/carbon nanohybrids under hydrothermal conditions.
| | Uses | D-(+)-Glucose is a common natural sugar involved in processes such as energy production, glycosylation, and formation of glycans that provide structure to cells. Glucose is involved in a detrimentatl process in cells called glycation. Glucose is used as a supplement for cell culture and in numerous cellular processes and molecular biology applications. | | Definition | ChEBI: D-Glucopyranose having alpha-configuration at the anomeric centre. | | IC 50 | Human Endogenous Metabolite; Microbial Metabolite | | Purification Methods | Recrystallise -D-glucose slowly from aqueous 80% EtOH, then dry it over P2O5 in vacuo. Alternatively, crystallise it from water at 55o, then dry it for 6hours in a vacuum oven between 60-70o/2mm. Its solubilities are: H2O (~50%), EtOH (1.7%). [Hendricks et al. J Am Chem Soc 56 99 1934, Beilstein 1 IV 4302.] [For equilibrium forms see Angyal Adv Carbohydr Chem 42 15 1984, Angyal & Pickles Aust J Chem 25 1711 1972.] |
| | DEXTROSE Preparation Products And Raw materials |
|