| Company Name: |
Shandong Boluoda Biological Technology Co., Ltd. Gold
|
| Tel: |
0531-68652053 15863796298; |
| Email: |
2310993908@qq.com |
| Products Intro: |
Product Name:Atorvastatin Impurity
CAS:906552-18-9
Purity:95% HPLC Package:10mg；25mg；50mg；100mg；200mg；500mg；1g
|
Atorvastatin Lactam Impurity manufacturers
|
| | Atorvastatin Lactam Impurity Basic information |
| Product Name: | Atorvastatin Lactam Impurity | | Synonyms: | Atorvastatin Lactam Impurity;1H-Pyrrole-1-heptanoic acid, 5-(4-fluorophenyl)-2,3-dihydro-β,δ-dihydroxy-3-(1-methylethyl)-2-oxo-4-phenyl-3-[(phenylamino)carbonyl]-, (βR,δR)-;(3R,5R)-7-(5-(4-fluorophenyl)-3-isopropyl-2-oxo-4-phenyl-3-(phenylcarbamoyl)-2,3-dihydro-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoic acid;Atorvastatin Acid - Impurity Q;Atorvastatin Impurity 27 Monomer;Atorvastatin calcium impurity 9;Atorvastatin Impurity 20 (Atorvastatin EP Impurity Q) | | CAS: | 906552-18-9 | | MF: | C33H35FN2O6 | | MW: | 574.65 | | EINECS: | | | Product Categories: | | | Mol File: | 906552-18-9.mol |  |
| | Atorvastatin Lactam Impurity Chemical Properties |
| Boiling point | 864.7±65.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | pka | 4.30±0.10(Predicted) | | InChIKey | IJPSBDFKAGUGAN-IKCUNAGZNA-N | | SMILES | C(C1(C(N(CC[C@@H](O)C[C@@H](O)CC(=O)O)C(C2C=CC(F)=CC=2)=C1C1C=CC=CC=1)=O)C(C)C)(=O)NC1C=CC=CC=1 |&1:6,9,r| |
| | Atorvastatin Lactam Impurity Usage And Synthesis |
| Uses | A photodegadation product of Atorvastatin (a cyclic impurity of Atorvastatin). |
| | Atorvastatin Lactam Impurity Preparation Products And Raw materials |
|