| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(R)-Butyryl Carnitine Chloride CAS:162067-50-7 Package:100Mg,1g
|
|
| | (R)-Butyryl Carnitine Chloride Basic information |
| | (R)-Butyryl Carnitine Chloride Chemical Properties |
| Melting point | 163-165C | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White Waxy | | Appearance | white solid | | Stability: | Hygroscopic | | InChIKey | SRYJSBLNSDMCEA-SBSPUUFOSA-N | | SMILES | Cl.[N+](C[C@H](OC(=O)CCC)CC(=O)[O-])(C)(C)C | | CAS Number Unlabeled | 162067-50-7 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-Butyryl Carnitine Chloride Usage And Synthesis |
| Description | Butyryl-L-carnitine is a butyrate ester of carnitine. It is an inhibitor of intestinal transporters, blocking carnitine uptake by the carnitine transporter and glycine transport by the amino acid transporter in human retinal pigment epithelial (HRPE) cells (IC50s = 1.5 μM and 4.6 mM, respectively). | | Chemical Properties | White Solid | | Uses | (R)-Butyryl Carnitine Chloride is a potential prodrug of Carnitine, used for treating seizure disorders. | | Uses | A potential prodrug, via the carnitine transporter OCTN2 and the amino acid transporter ATB0,+. | | References | [1] SONNE R SRINIVAS. Transport of butyryl-L-carnitine, a potential prodrug, via the carnitine transporter OCTN2 and the amino acid transporter ATB(0,+).[J]. American journal of physiology. Gastrointestinal and liver physiology, 2007: G1046-53. DOI: 10.1152/ajpgi.00233.2007 |
| | (R)-Butyryl Carnitine Chloride Preparation Products And Raw materials |
|