|
|
| | Atorvastatin Methyl Ester Basic information |
| Product Name: | Atorvastatin Methyl Ester | | Synonyms: | Atorvastatin Methyl Ester;Atorvastatin Impurity 6(Atorvastatin EP Impurity K);methyl (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate;methyl (3R,5R)-7-(2-(4-fluorophenyl)-5-isopropyl-3-phenyl- 4-(phenylcarbamoyl)-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoate;Atorvastatin Impurity J reference substance;Atorvastatin Calcium Hydrate impurity J;(3R,5R)-methyl 7-(2-(4-fluorophenyl)-;Atorvastatin calcium-7 | | CAS: | 345891-62-5 | | MF: | C34H37FN2O5 | | MW: | 572.67 | | EINECS: | 1312995-182-4 | | Product Categories: | Chiral Reagents;Impurities;Intermediates & Fine Chemicals;Pfizer compounds;Pharmaceuticals | | Mol File: | 345891-62-5.mol |  |
| | Atorvastatin Methyl Ester Chemical Properties |
| Melting point | 58-60°C | | Boiling point | 703.7±60.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | pka | 13.57±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChIKey | IRKGCTGBOBRSMG-WAFGLWLANA-N | | SMILES | C(OC)(=O)C[C@H](O)C[C@H](O)CCN1C(C(C)C)=C(C(=O)NC2=CC=CC=C2)C(C2=CC=CC=C2)=C1C1=CC=C(F)C=C1 |&1:5,8,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Atorvastatin Methyl Ester Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Atorvastatin impurity. Atorvastatin Methyl Ester |
| | Atorvastatin Methyl Ester Preparation Products And Raw materials |
|