| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:6-Methoxy-2-(tributylstannyl)pyrimidine
CAS:850501-35-8
Purity:98% Remarks:MR050070
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:6-Methoxy-2-(tributylstannyl)pyrimidine
CAS:850501-35-8
Purity:95% Package:1G Remarks:707031-1G
|
6-Methoxy-2-(tributylstannyl)pyrimidine manufacturers
|
| | 6-Methoxy-2-(tributylstannyl)pyrimidine Basic information |
| Product Name: | 6-Methoxy-2-(tributylstannyl)pyrimidine | | Synonyms: | 6-Methoxy-2-(tributylstannyl)pyrimidine;Pyrimidine, 4-methoxy-2-(tributylstannyl)-;6-Methoxy-2-(tributylstannyl)pyrimidine ISO 9001：2015 REACH;4-Methoxy-2-(tributylstannyl)pyrimidine;6-Methoxy-2-(tributylstannyl)pyrimidine, CAS 850501-35-8 | | CAS: | 850501-35-8 | | MF: | C17H32N2OSn | | MW: | 399.16 | | EINECS: | | | Product Categories: | | | Mol File: | 850501-35-8.mol |  |
| | 6-Methoxy-2-(tributylstannyl)pyrimidine Chemical Properties |
| density | 1.164 g/mL at 25 °C | | refractive index | n20/D1.507 | | form | liquid | | Boiling point | 293°C | | InChI | 1S/C5H5N2O.3C4H9.Sn/c1-8-5-2-3-6-4-7-5;3*1-3-4-2;/h2-3H,1H3;3*1,3-4H2,2H3; | | InChIKey | HQUSEOSQVFRYQV-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1nccc(OC)n1 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 6-Methoxy-2-(tributylstannyl)pyrimidine Usage And Synthesis |
| Uses | 6-Methoxy-2-(tributylstannyl)pyrimidine can be used as a reactant for the preparation of substituted pyrimidinone compounds via a Stille coupling reaction with aryl bromides. It can be also employed for the preparation of 4-methoxy-2-phenylpyrimidine by reacting with iodobenzene using Pd as a catalyst. | | General Description | 6-Methoxy-2-(tributylstannyl)pyrimidine is an organotin compound used in Stille coupling reaction. |
| | 6-Methoxy-2-(tributylstannyl)pyrimidine Preparation Products And Raw materials |
|