|
|
| | 2-Bromo-6-chloronaphthalene Basic information |
| | 2-Bromo-6-chloronaphthalene Chemical Properties |
| Melting point | 145-147°C | | Boiling point | 318.2±15.0 °C(Predicted) | | density | 1.592±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C10H6BrCl/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6H | | InChIKey | NDDRCPBWWONGJR-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(Cl)C=C2)=CC=C1Br |
| | 2-Bromo-6-chloronaphthalene Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | 2-Bromo-6-chloronaphthalene can be used in the preparation of azolylmethylpiperidines as serotonin, dopamine, and norepinephrine reuptake inhibitors. |
| | 2-Bromo-6-chloronaphthalene Preparation Products And Raw materials |
|