|
|
| | 5,6-Epoxy-13-cis Retinoic Acid Basic information |
| Product Name: | 5,6-Epoxy-13-cis Retinoic Acid | | Synonyms: | Isotretinoin Impurity 6（Isotretinoin EP Impurity G）;Isotretinoin EP Impurity G (5,6-Epoxy-13-cis Retinoic Acid);5,6-Epoxy-13-cis Retinoic Acid
;13-cis-5,6-Epoxy-5,6-dihydroretinoic Acid;Isotretinoin EP impurity G;(2Z,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenoic acid;13 cis 5,6 epoxy retinoic acid;Retinoic acid, 5,6-epoxy-5,6-dihydro-, 13-cis- | | CAS: | 81444-57-7 | | MF: | C20H28O3 | | MW: | 316.43 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Retinoids | | Mol File: | 81444-57-7.mol |  |
| | 5,6-Epoxy-13-cis Retinoic Acid Chemical Properties |
| Melting point | 176-178°C | | Boiling point | 455.3±18.0 °C(Predicted) | | density | 1.101±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.78±0.33(Predicted) | | color | Pale Yellow to Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C20H28O3/c1-15(8-6-9-16(2)14-17(21)22)10-13-20-18(3,4)11-7-12-19(20,5)23-20/h6,8-10,13-14H,7,11-12H2,1-5H3,(H,21,22)/b9-6+,13-10+,15-8+,16-14- | | InChIKey | KEEHJLBAOLGBJZ-NJZIYGCESA-N | | SMILES | C(O)(=O)/C=C(\C=C\C=C(\C=C\C12OC1(CCCC2(C)C)C)/C)/C |
| | 5,6-Epoxy-13-cis Retinoic Acid Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A metabolite of 13-cis-Retinoic Acid (R250000). |
| | 5,6-Epoxy-13-cis Retinoic Acid Preparation Products And Raw materials |
|