| Company Name: |
Rhawn Reagent Gold |
| Tel: |
400-1332688 18019345275 |
| Email: |
amy@rhawn.cn |
|
| | Cyclohexylmethyl Acetate Basic information |
| Product Name: | Cyclohexylmethyl Acetate | | Synonyms: | Cyclohexylmethyl Acetate;Acetic Acid Cyclohexylmethyl Ester;Cyclohexylmethyl Acetate >;Cyclohexanemethanol, 1-acetate | | CAS: | 937-55-3 | | MF: | C9H16O2 | | MW: | 156.22 | | EINECS: | | | Product Categories: | | | Mol File: | 937-55-3.mol |  |
| | Cyclohexylmethyl Acetate Chemical Properties |
| Boiling point | 183°C(lit.) | | refractive index | 1.4430-1.4470 | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C9H16O2/c1-8(10)11-7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 | | InChIKey | FXKHUBNHBYCRNH-UHFFFAOYSA-N | | SMILES | C(C1CCCCC1)OC(=O)C |
| | Cyclohexylmethyl Acetate Usage And Synthesis |
| Physical properties |
Cyclohexylmethyl Acetate is a colorless mobile liquid. Very slightly soluble in water, soluble in alcohol and oils.
| | Uses | Finds some use in perfume compositions. partly for Cyclohexylmethyl Acetate's fruity notes in lipstick compositions and in masking odors, partly for its Jasmin-like notes in low-cost floral fragrances for detergents, etc. It can partly or wholly replace Benzyl acetate in variations of Gardenia.
| | Preparation | Cyclohexylmethyl Acetate is prepared by azeotropic esterification of Cyclohexyl Methyialcohol with Acetic acid.
| | Synthesis Reference(s) | Synthetic Communications, 17, p. 1749, 1987 DOI: 10.1080/00397918708077318 |
| | Cyclohexylmethyl Acetate Preparation Products And Raw materials |
|