| Company Name: |
cjbscvictory Gold
|
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
| Products Intro: |
Product Name:2-Desoxy-4-epi-pulchellin
CAS:122872-03-1
Purity:HPLC≥98% Package:5mg；10mg；20mg；50mg；100mg；200mg
|
|
| | 2-Desoxy-4-epi-pulchellin Basic information |
| Product Name: | 2-Desoxy-4-epi-pulchellin | | Synonyms: | 2-Desoxy-4-epi-pulchellin;2,6-Dideacetoxybritanin;2Desoxy4epipulchellin,inhibit,2 Desoxy 4 epi pulchellin,Inhibitor;Azuleno[6,5-b]furan-2(3H)-one, decahydro-5-hydroxy-4a,8-dimethyl-3-methylene-, (3aR,4aS,5S,7aS,8R,9aS)-;2-Desoxy-4-epi-pulchellin, 10 mM in DMSO;(3aR,4aS,5S,7aS,8R,9aS)-5-Hydroxy-4a,8-dimethyl-3-methylenedecahydroazuleno[6,5-b]furan-2(3H)-one | | CAS: | 122872-03-1 | | MF: | C15H22O3 | | MW: | 250.33 | | EINECS: | | | Product Categories: | Sesquiterpenoids | | Mol File: | 122872-03-1.mol |  |
| | 2-Desoxy-4-epi-pulchellin Chemical Properties |
| Melting point | 135 °C | | Boiling point | 408.2±45.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 15.03±0.60(Predicted) | | color | White to off-white | | InChI | InChI=1S/C15H22O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h8,10-13,16H,2,4-7H2,1,3H3/t8-,10-,11+,12+,13+,15+/m1/s1 | | InChIKey | BOPADYWRUULRBD-MBICNOSFSA-N | | SMILES | O1C(=O)C(=C)[C@@]2([H])C[C@@]3(C)[C@@]([H])(CC[C@@H]3O)[C@H](C)C[C@]12[H] |
| | 2-Desoxy-4-epi-pulchellin Usage And Synthesis |
| Description | 2-Desoxy-4-epi-pulchellin has potent in vitro cytotoxicities against the K562, MCF-7, Hela, DU145, U937, H1975, SGC-7901, A549, MOLT-4, and HL60 cell lines with IC50 values ranging from 0.10 to 46.7uM, while it shows significant antiviral (H1N1 and H3N2) activities, it also displays significant antimycobacterial activity (IC50=7.6 uM). | | Uses | 2-Desoxy-4-epi-pulchellin (compound 13) is a compound isolated from dichloromethane-soluble portion of Polygonum hydropiper[1]. | | target | Antifection | | References | [1] Xiao H, et al. Biological evaluation of phytoconstituents from Polygonum hydropiper. Nat Prod Res. 2017;31(17):2053-2057. DOI:10.1080/14786419.2016.1269094 |
| | 2-Desoxy-4-epi-pulchellin Preparation Products And Raw materials |
|