|
|
| | 4-Chloro-pyrimidine-5-carboxylic acid ethyl ester Basic information |
| | 4-Chloro-pyrimidine-5-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 278.2±20.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -1.62±0.16(Predicted) | | form | semi-solid | | color | Yellow | | InChI | InChI=1S/C7H7ClN2O2/c1-2-12-7(11)5-3-9-4-10-6(5)8/h3-4H,2H2,1H3 | | InChIKey | AZJAMMCCAZZXIK-UHFFFAOYSA-N | | SMILES | C1=NC=C(C(OCC)=O)C(Cl)=N1 |
| | 4-Chloro-pyrimidine-5-carboxylic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 4-Chloro-5-pyrimidinecarboxylate is a reagent used in the synthesis of a series of novel orally active non-peptide angiotensin II antagonists. | | Synthesis | Ethyl 4-hydroxy-5-pyrimidinecarboxylate (380 mg, 2.26 mmol) was dissolved in tetrahydrofuran (THF, 5 mL) and thionyl chloride (1.65 mL, 22.6 mmol) was added slowly. The reaction mixture was heated to reflux and kept for 4 hours. Upon completion of the reaction, the reaction solution was concentrated by rotary evaporator under reduced pressure to give 417 mg (99% yield) of ethyl 4-chloropyrimidine-5-carboxylate as crude product. The crude product could be used directly in the subsequent reaction without further purification or characterization. | | References | [1] Patent: WO2006/91506, 2006, A2. Location in patent: Page/Page column 40 [2] Patent: WO2006/49681, 2006, A2. Location in patent: Page/Page column 38 [3] Patent: WO2006/121588, 2006, A2. Location in patent: Page/Page column 44 [4] Patent: WO2006/121860, 2006, A2. Location in patent: Page/Page column 44 [5] Patent: WO2006/121904, 2006, A1. Location in patent: Page/Page column 44 |
| | 4-Chloro-pyrimidine-5-carboxylic acid ethyl ester Preparation Products And Raw materials |
|