| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(2,4-Dichloro-phenyl)-ethylamine Basic information | | Application |
| | 1-(2,4-Dichloro-phenyl)-ethylamine Chemical Properties |
| Boiling point | 132 °C / 15mmHg | | density | 1.262±0.06 g/cm3(Predicted) | | refractive index | 1.56 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | pka | 8.28±0.10(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C8H9Cl2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3 | | InChIKey | OUVZHZAOWDHBOU-UHFFFAOYSA-N | | SMILES | C(C1C=CC(Cl)=CC=1Cl)(N)C | | CAS DataBase Reference | 89981-75-9(CAS DataBase Reference) |
| | 1-(2,4-Dichloro-phenyl)-ethylamine Usage And Synthesis |
| Application | 1-(2,4-Dichlorophenyl)ethylamine can be used as an organic synthesis intermediate and a pharmaceutical intermediate, and can be used in laboratory research and development processes as well as in chemical and pharmaceutical production processes. |
| | 1-(2,4-Dichloro-phenyl)-ethylamine Preparation Products And Raw materials |
|