|
|
| | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole Basic information | | Uses |
| Product Name: | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole | | Synonyms: | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole;N-Octyldithieno[3,2-b:2',3'-d]pyrrole;4-Octyl-4H-dithieno[3,2-b;4-n-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole;4-n-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole;4-n-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole>4H-Dithieno[3,2-b:2',3'-d]pyrrole, 4-octyl-;S1271 | | CAS: | 141029-75-6 | | MF: | C16H21NS2 | | MW: | 291.47 | | EINECS: | | | Product Categories: | | | Mol File: | 141029-75-6.mol | ![4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole Structure](CAS/GIF/141029-75-6.gif) |
| | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole Chemical Properties |
| Melting point | 35℃ | | Boiling point | 424.2±38.0 °C(Predicted) | | density | 1.19 | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C16H21NS2/c1-2-3-4-5-6-7-10-17-13-8-11-18-15(13)16-14(17)9-12-19-16/h8-9,11-12H,2-7,10H2,1H3 | | InChIKey | GGCJLBJHTUIOES-UHFFFAOYSA-N | | SMILES | N1(CCCCCCCC)C2C=CSC=2C2SC=CC1=2 |
| | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole Usage And Synthesis |
| Uses | N-Octyldithiopheno(3,2-B2,3-D)pyrrole is a thiophene derivative that can be used as an organic intermediate. | | Synthesis | In a 50mL double-necked vial, 3,3'-dibromo-2,2'-bithiophene (2.5g, 7.71mmol), sodium tert-butoxide (1.85g, 19.29mmol) were dissolved in 15mL toluene, and after deoxygenation by nitrogen bubbling for 10 minutes, tris(dibenzylideneacetone)dipalladium (211.94mg, 0.231 mmol) and 1,1'-binaphthyl-2,2'-bisdiphenylphosphine (480.40 mg, 0.771 mmol) under nitrogen protection, and then slowly added n-octylamine (997.13 mg, 7.71 mmol) dropwise to the mixture, and the reaction was heated up to 110 overnight. -D) pyrrole (1.8 g, 80%). |
| | 4-Octyl-4H-dithieno[3,2-b:2',3'-d]pyrrole Preparation Products And Raw materials |
|