|
|
| | 4-(4-Fluorophenyl)-1-Methyl- Basic information |
| | 4-(4-Fluorophenyl)-1-Methyl- Chemical Properties |
| Melting point | 171-174°C | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C12H14FN.ClH/c1-14-8-6-11(7-9-14)10-2-4-12(13)5-3-10;/h2-6H,7-9H2,1H3;1H | | InChIKey | ASGHTQNAMCDXPA-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)C2=CCN(CC2)C.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 |
| | 4-(4-Fluorophenyl)-1-Methyl- Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | The active metabolite of 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine (MPTP) (M325910), N-Methyl-4-phenylpyridinium (MPP+), selectively destroys the dopaminergic neurons and induces the symptoms of Parkinson's disease. |
| | 4-(4-Fluorophenyl)-1-Methyl- Preparation Products And Raw materials |
|