| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 2-(1-Methylcyclopropyl)acetic acid Basic information |
| Product Name: | 2-(1-Methylcyclopropyl)acetic acid | | Synonyms: | 2-(1-Methylcyclopropyl)acetic acid;1-methyl Cyclopropaneacetic acid;(1-Methyl-cyclopropyl)-acetic acid;Cyclopropaneacetic acid, 1-methyl-;2-(1-methylcyclopropyl)acetic acid - [M87299] | | CAS: | 71199-15-0 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | | | Product Categories: | | | Mol File: | 71199-15-0.mol |  |
| | 2-(1-Methylcyclopropyl)acetic acid Chemical Properties |
| Boiling point | 200.5±8.0 °C(Predicted) | | density | 1.098±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.76±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H10O2/c1-6(2-3-6)4-5(7)8/h2-4H2,1H3,(H,7,8) | | InChIKey | AOPATQAZIRXNOX-UHFFFAOYSA-N | | SMILES | C1(C)(CC(O)=O)CC1 |
| | 2-(1-Methylcyclopropyl)acetic acid Usage And Synthesis |
| | 2-(1-Methylcyclopropyl)acetic acid Preparation Products And Raw materials |
|