2,4,6-trihydroxyisophthalaldehyde manufacturers
|
| | 2,4,6-trihydroxyisophthalaldehyde Basic information |
| Product Name: | 2,4,6-trihydroxyisophthalaldehyde | | Synonyms: | 2,4,6-trihydroxyisophthalaldehyde;2,4-diforMyl phloroglucinol;Diformylphloroglucinol;Phloroglucinol Diformyl;1,3-Benzenedicarboxaldehyde, 2,4,6-trihydroxy-;2,4,6-Trihydroxy-3-formylbenzaldehyde;Penicillamine Impurity 16;2,4-diformylmetabenzenetriphenol | | CAS: | 4396-13-8 | | MF: | C8H6O5 | | MW: | 182.13 | | EINECS: | | | Product Categories: | | | Mol File: | 4396-13-8.mol |  |
| | 2,4,6-trihydroxyisophthalaldehyde Chemical Properties |
| Melting point | >129oC (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Pink to Orange | | InChI | InChI=1S/C8H6O5/c9-2-4-6(11)1-7(12)5(3-10)8(4)13/h1-3,11-13H | | InChIKey | XMOLQZRXGOOMRJ-UHFFFAOYSA-N | | SMILES | C1(C=O)=C(O)C=C(O)C(C=O)=C1O |
| | 2,4,6-trihydroxyisophthalaldehyde Usage And Synthesis |
| Uses | Diformylphloroglucinol is an impurity in the synthesis of Hirsutidin Chloride (H356800), which is an anthocyanidin found in the Madagascar Periwinkle (Catharanthus Roseus). Hirsutidin Chloride can be used in the preparation of plant based compounds to lower LDL cholesterol. |
| | 2,4,6-trihydroxyisophthalaldehyde Preparation Products And Raw materials |
|