| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
|
| | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate Basic information |
| Product Name: | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate | | Synonyms: | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate;(2-BROMO-6-CHLORO-PYRIDIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER;N-(2-Bromo-6-chloro-3-pyridinyl)carbamic acid 1,1-dimethylethyl ester;Tert-butyl N-(2-bromo-6-chloropyridin-3-yl)carbamate;100009;Carbamic acid, N-(2-bromo-6-chloro-3-pyridinyl)-, 1,1-dimethylethyl ester;3-(Boc-amino)-2-bromo-6-chloropyridine, 95% | | CAS: | 1227958-32-8 | | MF: | C10H12BrClN2O2 | | MW: | 307.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1227958-32-8.mol |  |
| | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate Chemical Properties |
| Boiling point | 325.5±42.0 °C(Predicted) | | density | 1.539±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.13±0.70(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C10H12BrClN2O2/c1-10(2,3)16-9(15)13-6-4-5-7(12)14-8(6)11/h4-5H,1-3H3,(H,13,15) | | InChIKey | ZFFFXKCZHWHRET-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=C(Cl)N=C1Br |
| | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate Usage And Synthesis |
| Uses | tert-Butyl (2-Bromo-6-chloropyridin-3-yl)carbamate is used as a reactant in the industrial manufacture of an Akt kinase inhibitor. |
| | tert-butyl 2-broMo-6-chloropyridin-3-ylcarbaMate Preparation Products And Raw materials |
|