|
|
| | p-Nicorandil Basic information |
| | p-Nicorandil Chemical Properties |
| Melting point | 109-111°C | | Boiling point | 456.7±25.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetone (Slightly), DMSO (Slightly) | | form | Solid | | pka | 12.38±0.46(Predicted) | | color | Pale Yellow to Pale Beige | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C8H9N3O4/c12-8(7-1-3-9-4-2-7)10-5-6-15-11(13)14/h1-4H,5-6H2,(H,10,12) | | InChIKey | VZCYAIHIDPPQHC-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])OCCNC(=O)c1ccncc1 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | p-Nicorandil Usage And Synthesis |
| Uses | A positional isomeric impurity of the antianginal Nicorandil (N398500). |
| | p-Nicorandil Preparation Products And Raw materials |
|