4-AdaMantyl-1-broMobenzene manufacturers
- 4-AdaMantyl-1-broMobenzene
-
- $101.00 / 1KG
-
2025-09-25
- CAS:2245-43-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-AdaMantyl-1-broMobenzene Basic information |
| Product Name: | 4-AdaMantyl-1-broMobenzene | | Synonyms: | 4-AdaMantyl-1-broMobenzene;Tricyclo[3.3.1.13,7]decane, 1-(4-bromophenyl)-;4-Adamantyl bromobenzene;1-(4-Bromophenyl)adamantane,95%;4-goldalkaneylbromobenzene;1-(4-Bromophenyl)adamantane | | CAS: | 2245-43-4 | | MF: | C16H19Br | | MW: | 291.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2245-43-4.mol |  |
| | 4-AdaMantyl-1-broMobenzene Chemical Properties |
| Melting point | 102-103℃ (methanol ) | | Boiling point | 351.0±21.0 °C(Predicted) | | density | 1.357±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H19Br/c17-15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16/h1-4,11-13H,5-10H2 | | InChIKey | KCZDTZZRNNRKQE-UHFFFAOYSA-N | | SMILES | C12(C3=CC=C(Br)C=C3)CC3CC(CC(C3)C1)C2 |
| | 4-AdaMantyl-1-broMobenzene Usage And Synthesis |
| | 4-AdaMantyl-1-broMobenzene Preparation Products And Raw materials |
|