- 1,2-Cyclohexanediol
-
-
2025-06-27
- CAS:931-17-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | 1,2-Cyclohexanediol Basic information |
| Product Name: | 1,2-Cyclohexanediol | | Synonyms: | 1,2-Benzenediol, hexahydro-;1,2-Cyclohexanediol cis-trans;1,2-cyclohexanediol(cis-andtrans-mixture;1,2-Cyclohexanediol,c&t;1,2-cyclohexanediol,mixtureofcisandtrans;2-Hydroxycyclohexanol;Brenzcatechin;Brenzkatechin | | CAS: | 931-17-9 | | MF: | C6H12O2 | | MW: | 116.16 | | EINECS: | 213-229-8 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 931-17-9.mol |  |
| | 1,2-Cyclohexanediol Chemical Properties |
| Melting point | 73-77 °C | | Boiling point | 118-120 °C (10 mmHg) | | density | 0.9958 (rough estimate) | | refractive index | 1.4270 (estimate) | | Fp | 118-120°C/10mm | | storage temp. | Inert atmosphere,Room Temperature | | pka | 14.49±0.40(Predicted) | | form | Crystalline Powder | | color | White to off-white | | Water Solubility | Soluble | | Henry's Law Constant | 6.6×102 mol/(m3Pa) at 25℃, Wang et al. (2017) | | InChI | InChI=1S/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 | | InChIKey | PFURGBBHAOXLIO-UHFFFAOYSA-N | | SMILES | C1(O)CCCCC1O | | CAS DataBase Reference | 931-17-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2-Cyclohexanediol(931-17-9) |
| Safety Statements | 24/25-23 | | RTECS | GV0220000 | | HS Code | 29061990 |
| | 1,2-Cyclohexanediol Usage And Synthesis |
| Chemical Properties | WHITE TO OFF-WHITE CRYSTALLINE POWDER | | Uses | 1,2-Cyclohexanediol is used as a pharmaceutical intermediate. | | Definition | ChEBI: A diol that consists of a cyclohexane skeleton carrying two hydroxy substituents. |
| | 1,2-Cyclohexanediol Preparation Products And Raw materials |
|