|
|
| | Methyl 2-Fluoro-5-Methylbenzoate Basic information |
| | Methyl 2-Fluoro-5-Methylbenzoate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H9FO2/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5H,1-2H3 | | InChIKey | KPJYZNQMHXINEO-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(C)=CC=C1F |
| | Methyl 2-Fluoro-5-Methylbenzoate Usage And Synthesis |
| Chemical Properties | Off-white powder | | References | [1] Patent: WO2006/2342, 2006, A1. Location in patent: Page/Page column 218-219 |
| | Methyl 2-Fluoro-5-Methylbenzoate Preparation Products And Raw materials |
|