5-O-Methylnaringenin manufacturers
- 5-O-Methylnaringenin
-
- $1.00 / 1KG
-
2020-01-05
- CAS:61775-19-7
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | 5-O-Methylnaringenin Basic information |
| Product Name: | 5-O-Methylnaringenin | | Synonyms: | 5-O-Methylnaringenin;(S)-7-Hydroxy-2-(4-hydroxyphenyl)-5-MethoxychroMan-4-one;7,4′-Dihydroxy-5-methoxyflavanone;Naringenin 5-O-methyl ether;4H-1-Benzopyran-4-one, 2,3-dihydro-7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-, (2S)-;5-O-Methylnaringenin >=95% (LC/MS-ELSD);(2S)-7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-2,3-dihydrochromen-4-one;5-Methoxynaringenin | | CAS: | 61775-19-7 | | MF: | C16H14O5 | | MW: | 286.28 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 61775-19-7.mol |  |
| | 5-O-Methylnaringenin Chemical Properties |
| Melting point | 231-232 °C | | Boiling point | 555.9±50.0 °C(Predicted) | | density | 1.370±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 7.35±0.40(Predicted) | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C16H14O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-7,13,17-18H,8H2,1H3/t13-/m0/s1 | | InChIKey | CWZLMWSCLBFCBY-ZDUSSCGKSA-N | | SMILES | COc1cc(O)cc2O[C@@H](CC(=O)c12)c3ccc(O)cc3 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | 5-O-Methylnaringenin Usage And Synthesis |
| Uses | metabolomics
vitamins, nutraceuticals, and natural products |
| | 5-O-Methylnaringenin Preparation Products And Raw materials |
|