| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alabiotech Inc. |
| Tel: |
001-619-354-5251 |
| Email: |
sales@alabiotech-e.com |
|
| | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid Basic information |
| Product Name: | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid | | Synonyms: | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid;cis-FMoc-Pro(4-N3)-OH;Fmoc-L-Pro(4-N3)-OH (2S,4S);Fmoc-cis-N3-Pro-OH;Fmoc-L-cis-4-azidoproline;(2S,4S)-4-Azido-1,2-pyrrolidinedicarboxylic acid 1-(9H-fluoren-9-ylmethyl) ester;(2S,4S)-Fmoc-4-azido-pyrrolidine-2-carboxylic acid≥ 99% (HPLC);Fmoc-cis-Pro(4-azido)-OH | | CAS: | 263847-08-1 | | MF: | C20H18N4O4 | | MW: | 378.38 | | EINECS: | | | Product Categories: | amino acids | | Mol File: | 263847-08-1.mol |  |
| | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid Chemical Properties |
| storage temp. | Store at -15°C to -25°C. | | form | Solid | | pka | 3.574±0.40(predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C20H18N4O4/c21-23-22-12-9-18(19(25)26)24(10-12)20(27)28-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17-18H,9-11H2,(H,25,26)/t12-,18-/m0/s1 | | InChIKey | HOPXMBBEYJTPNX-SGTLLEGYSA-N | | SMILES | [N+](=[N-])=N[C@@H]1CN([C@@H](C1)C(=O)O)C(=O)OCC2c3c(cccc3)c4c2cccc4 |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | peptide synthesis | | General Description | A useful tool for the synthesis of branched, side-chain modified and cyclic peptides by Fmoc SPPS. The side-chain azido group is completely stable to piperidine and TFA, but can be readily converted to an amine on the solid phase or in solution by reduction with thiols [1] or phosphines [2, 3]. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (2S,4S)-1-fMoc-4-azidopyrrolidine-2-carboxylic acid Preparation Products And Raw materials |
|