|
|
| | 1-Methyl-6-nitro-1H-indole Basic information |
| | 1-Methyl-6-nitro-1H-indole Chemical Properties |
| Melting point | 76.5-78.5 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 140-160 °C(Press: 0.1 Torr) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C9H8N2O2/c1-10-5-4-7-2-3-8(11(12)13)6-9(7)10/h2-6H,1H3 | | InChIKey | AYGFFYXMDIOSFO-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1cc2[n](ccc2cc1)C |
| HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 1-Methyl-6-nitro-1H-indole Usage And Synthesis |
| | 1-Methyl-6-nitro-1H-indole Preparation Products And Raw materials |
|