| Company Name: |
Shanghai Jizhi Biochemical Technology Co. Ltd.
|
| Tel: |
021-4009004166/18616739031 18616739031 |
| Email: |
3007523370@qq.com |
| Products Intro: |
Product Name:Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate
CAS:1375064-53-1
Purity:- Package:1g;5g Remarks:M66640
|
| Company Name: |
Accela ChemBio Co.,Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
sales@accelachem.com |
| Products Intro: |
Product Name:Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate
CAS:1375064-53-1
Purity:>97% Package:0.1g;0.25g;1g;5g
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Methyl 5-(1-methyl-1H-pyrrol-2-yl)-3-isoxazolecarboxylate
CAS:1375064-53-1
|
|
| | Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate Basic information |
| | Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate Chemical Properties |
| InChI | 1S/C10H10N2O3/c1-12-5-3-4-8(12)9-6-7(11-15-9)10(13)14-2/h3-6H,1-2H3 | | InChIKey | QOTQMCIMLRRIDB-UHFFFAOYSA-N | | SMILES | [n]1(c(ccc1)c2[o]nc(c2)C(=O)OC)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate Usage And Synthesis |
| | Methyl 5-(1-Methyl-2-pyrrolyl)isoxazole-3-carboxylate Preparation Products And Raw materials |
|