| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 1H-Indole, 7-(4-Methyl-1-piperazinyl)-3-(phenylsulfonyl)- Basic information |
| | 1H-Indole, 7-(4-Methyl-1-piperazinyl)-3-(phenylsulfonyl)- Chemical Properties |
| Melting point | 160-162 °C | | Boiling point | 596.8±50.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: >10mg/mL | | form | powder | | pka | 15.49±0.30(Predicted) | | color | off-white | | InChI | 1S/C19H21N3O2S/c1-21-10-12-22(13-11-21)17-9-5-8-16-18(14-20-19(16)17)25(23,24)15-6-3-2-4-7-15/h2-9,14,20H,10-13H2,1H3 | | InChIKey | AOPYPEADLGTXRA-UHFFFAOYSA-N | | SMILES | CN1CCN(CC1)c2cccc3c(c[nH]c23)S(=O)(=O)c4ccccc4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1H-Indole, 7-(4-Methyl-1-piperazinyl)-3-(phenylsulfonyl)- Usage And Synthesis |
| Uses | Ro4368554 is a selective 5-Hydroxytryptamine 6 (5-HT6) receptor antagonists. | | Biochem/physiol Actions | Ro4368554 is a 5-HT6 receptor antagonist. RO4368554 acts selectively at 5-HT6 receptors where it binds with a greater than 100-fold selectivity over other monoamine receptor subtypes (-log M pKi = 9.4 at 5-HT6 and 7.1 at 5-HT2A). | | IC 50 | 5-HT6 Receptor |
| | 1H-Indole, 7-(4-Methyl-1-piperazinyl)-3-(phenylsulfonyl)- Preparation Products And Raw materials |
|