- Trenbolone Enanthate
-
- $1.00 / 1KG
-
2026-05-15
- CAS:2322-77-2
- Min. Order: 1KG
- Purity: 99.9%
- Supply Ability: 500KG
- Trenbolone Enanthate
-
- $1.00 / 10g
-
2026-05-15
- CAS:2322-77-2
- Min. Order: 1g
- Purity: 99.8%
- Supply Ability: 1
- Methoxydienone
-
-
2026-05-15
- CAS:2322-77-2
- Min. Order:
- Purity: 0.99
- Supply Ability:
|
| | Methoxydienone Basic information |
| Product Name: | Methoxydienone | | Synonyms: | (13S)-13β-Ethyl-3-methoxygona-2,5(10)-dien-17-one;Levonorgestrel IMpurity R;Methoxydienone Max LMG;Gona-2,5(10)-dien-17-one,13-ethyl-3-Methoxy-;13-ethyl-3-methoxy-gona-2,5(10)-dien-17-one 90% (Methoxydienone;13-beta-Ethyl-3-methoxy-;na-2,5(10)-dien-17-one;3-Mehoxy-18-Methyestra-2,5(10)-dien-17-one | | CAS: | 2322-77-2 | | MF: | C20H28O2 | | MW: | 300.44 | | EINECS: | 219-034-4 | | Product Categories: | Other APIs | | Mol File: | 2322-77-2.mol |  |
| | Methoxydienone Chemical Properties |
| Melting point | 122-124 °C | | Boiling point | 448.0±45.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | Water Solubility | 270μg/L at 20℃ | | InChI | InChI=1S/C20H28O2/c1-3-20-11-10-16-15-7-5-14(22-2)12-13(15)4-6-17(16)18(20)8-9-19(20)21/h5,16-18H,3-4,6-12H2,1-2H3/t16-,17-,18+,20+/m1/s1 | | InChIKey | PQMRKLSVUBRLLQ-XSYGEPLQSA-N | | SMILES | C1(OC)CC2=C(CC=1)[C@]1([H])[C@]([H])([C@@]3([H])[C@](CC)(CC1)C(=O)CC3)CC2 | | LogP | 5.86 at 25℃ | | CAS DataBase Reference | 2322-77-2(CAS DataBase Reference) |
| | Methoxydienone Usage And Synthesis |
| Chemical Properties | Crystalline compound. Melting point 150-160°C. | | Uses | Max LMG is a progestin derived steroid and not a 17-alpha alkylated steroid. Max LMG is structurally related to RU-486 and acts as an antiprogesterone, decreasing estrogen-like effects. | | Flammability and Explosibility | Non flammable |
| | Methoxydienone Preparation Products And Raw materials |
|