- Norandrostenedione
-
- $5.00/ KG
-
2026-01-22
- CAS:734-32-7
- Min. Order: 1KG
- Purity: 99% hplc
- Supply Ability: 500TONS
- Norandrostenedione
-
- $0.00 / 1kg
-
2026-01-19
- CAS:734-32-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10T
|
| | Norandrostenedione Basic information |
| Product Name: | Norandrostenedione | | Synonyms: | (8R,9S,10R,13S,14S)-13-methyl-7,8,9,10,11,12,13,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17(2H,6H)-dione*;Norethisterone Impurity B;Norandrostenedione/19-Norandrost-4-ene-3,17-dione/19-NOR-4-ANDROSTEN-3,17-DIONE;19-NOR-4-ANDROSTENEDIONE;19-NORANDROST-4-ENE-3,17-DIONE;19-NORANDROSTENDIONE;19-NORANDROSTENE-3,17-DIONE;19-NORANDROSTENEDIONE | | CAS: | 734-32-7 | | MF: | C18H24O2 | | MW: | 272.38 | | EINECS: | 211-995-8 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids;Miscellaneous Biochemicals;734-32-7 | | Mol File: | 734-32-7.mol |  |
| | Norandrostenedione Chemical Properties |
| Melting point | 169-172°C | | alpha | +134～+143°(D/25℃)(c=0.5,C2H5OH) | | Boiling point | 433.4±45.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | storage temp. | Refrigerator | | solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml | | form | A crystalline solid | | Water Solubility | 191mg/L at 20℃ | | InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-16H,2-9H2,1H3/t13-,14+,15+,16-,18-/m0/s1 | | InChIKey | JRIZOGLBRPZBLQ-QXUSFIETSA-N | | SMILES | C1(=O)C=C2[C@]([H])(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC2 | | LogP | 2.18 at 25℃ | | CAS DataBase Reference | 734-32-7(CAS DataBase Reference) |
| | Norandrostenedione Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Norethindrone intermediate | | Definition | ChEBI: 19-Norandrostenedione is a 3-oxo steroid. | | Flammability and Explosibility | Not classified |
| | Norandrostenedione Preparation Products And Raw materials |
|