|
|
| | (1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid Basic information |
| Product Name: | (1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid | | Synonyms: | AKOS BBS-00007699;TIMTEC-BB SBB011788;3-Azabicyclo[3.2.1]octane-3-acetic acid, 1,8,8-trimethyl-2,4-dioxo-;(1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid | | CAS: | 1212-95-9 | | MF: | C12H17NO4 | | MW: | 239.27 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![(1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid Structure](StructureFile/ChemBookStructure5/GIF/CB5260955.gif) |
| | (1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid Chemical Properties |
| Melting point | 169 °C | | Boiling point | 431.2±28.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | pka | 3.74±0.10(Predicted) | | form | solid | | InChI | 1S/C12H17NO4/c1-11(2)7-4-5-12(11,3)10(17)13(9(7)16)6-8(14)15/h7H,4-6H2,1-3H3,(H,14,15)/t7-,12+/m0/s1 | | InChIKey | LBMVFGRSRGURMJ-JVXZTZIISA-N | | SMILES | C[C@@]1(CC[C@](C2=O)([H])C(C)1C)C(N2CC(O)=O)=O |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | (1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid Usage And Synthesis |
| | (1,8,8-Trimethyl-2,4-dioxo-3-aza-bicyclo[3.2.1]-oct-3-yl)-acetic acid Preparation Products And Raw materials |
|