|
|
| | 1-Phenyl-4-methyl-3-pyrazolidone Basic information |
| | 1-Phenyl-4-methyl-3-pyrazolidone Chemical Properties |
| Melting point | 133-136 °C | | Boiling point | 307.83°C (rough estimate) | | density | 1.1102 (rough estimate) | | vapor pressure | 0.001Pa at 25℃ | | refractive index | 1.7110 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Methanol | | pka | 9.54±0.70(Predicted) | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | 754.801mg/L at 30℃ | | InChI | InChI=1S/C10H12N2O/c1-8-7-12(11-10(8)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,13) | | InChIKey | ZZEYCGJAYIHIAZ-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)CC(C)C(=O)N1 | | LogP | 0.624 at 25℃ | | CAS DataBase Reference | 2654-57-1(CAS DataBase Reference) | | EPA Substance Registry System | 3-Pyrazolidinone, 4-methyl-1-phenyl- (2654-57-1) |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-51/53 | | Safety Statements | 24/25 | | RIDADR | 2811 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29331990 |
| | 1-Phenyl-4-methyl-3-pyrazolidone Usage And Synthesis |
| Chemical Properties | SLIGHTLY YELLOW TO BEIGE FINE CRYSTALLINE POWDER | | Flammability and Explosibility | Not classified |
| | 1-Phenyl-4-methyl-3-pyrazolidone Preparation Products And Raw materials |
|