| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:(S)-(+)-Naproxen Chloride
CAS:51091-84-0
Purity:对照品 Package:10mg~500mg Remarks:AC000634024
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:(S)-2-(6-Methoxynaphthalen-2-yl)propanoyl chloride
CAS:51091-84-0
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:S-(+)-Naproxen chloride
CAS:51091-84-0
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | (S)-(+)-Naproxen chloride Basic information |
| Product Name: | (S)-(+)-Naproxen chloride | | Synonyms: | (S)-(+)-Naproxen chloride;(S)-(+)-Naproxen chloride >=97.0%;NAPRO-017;2-Naphthaleneacetyl chloride, 6-methoxy-α-methyl-, (αS)-;(2S)-2-(6-methoxy-2-naphthyl)propanoyl chloride;(S)-2-(6-Methoxy-2-naphthyl)propanoyl Chloride;(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride;Sparsentan Impurity 14 | | CAS: | 51091-84-0 | | MF: | C14H13ClO2 | | MW: | 248.7 | | EINECS: | | | Product Categories: | | | Mol File: | 51091-84-0.mol |  |
| | (S)-(+)-Naproxen chloride Chemical Properties |
| Melting point | 94-96 °C | | Boiling point | 371.6±25.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystals | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D +67.0±3.0°, c = 1 in methylene chloride | | InChI | 1S/C14H13ClO2/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3/t9-/m0/s1 | | InChIKey | UODROGXCIVAQDJ-VIFPVBQESA-N | | SMILES | COc1ccc2cc(ccc2c1)[C@H](C)C(Cl)=O |
| Hazard Codes | Xi | | Risk Statements | 36-52 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | (S)-(+)-Naproxen chloride Usage And Synthesis |
| | (S)-(+)-Naproxen chloride Preparation Products And Raw materials |
|