| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Basic information | | Uses |
| Product Name: | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate | | Synonyms: | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate;(4-Methylphenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate;Mesityl(p-tolyl)iodonium triflate;Iodonium, (4-?methylphenyl)?(2,?4,?6-?trimethylphenyl)?-?, 1,?1,?1-?trifluoromethanesulf?onate (1:1);Mesityl(p-tolyl)iodonium trifluoromethanesulfonate;(4-tolyl) (2,4,6-trimethylphenyl) iodonium trifluoromethanesulfonate;(4-METHYLPHENYL)(2,4,6-TRIMETHYLPHENYL)I | | CAS: | 1204518-02-4 | | MF: | C17H18F3IO3S | | MW: | 486.2876996 | | EINECS: | | | Product Categories: | | | Mol File: | 1204518-02-4.mol |  |
| | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Chemical Properties |
| Melting point | 177.0 to 182.0 °C | | storage temp. | 2-8°C, sealed storage, away from moisture | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow to Dark green | | BRN | 20040208 | | InChI | InChI=1S/C16H18I.CHF3O3S/c1-11-5-7-15(8-6-11)17-16-13(3)9-12(2)10-14(16)4;2-1(3,4)8(5,6)7/h5-10H,1-4H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | KVLSSMIQFXWHII-UHFFFAOYSA-M | | SMILES | [I+](C1=CC=C(C)C=C1)C1=C(C)C=C(C)C=C1C.S(C(F)(F)F)([O-])(=O)=O |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2904.10.3700 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Usage And Synthesis |
| Uses | (4-Methylphenyl)(2,4,6-trimethylphenyl)iodonium Triflate is a reagent used in organic synhesis, normally applied in arylation reactions and in iodonium metathesis reactions. | | Uses | (4-Methylphenyl)(2,4,6-trimethylphenyl)iodonium Triflate is a reagent used in organic synhesis, normally applied in arylation reactions and in iodonium metathesis reactions. |
| | (4-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate Preparation Products And Raw materials |
|