- kb NB 142-70
-
- $40.00 / 1mg
-
2026-03-13
- CAS:1233533-04-4
- Min. Order:
- Purity: 99.64%
- Supply Ability: 10g
|
| | 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one Basic information |
| Product Name: | 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one | | Synonyms: | kb-NB142-70 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one;3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one;CS-2453;kbNB142-70, >98%;[1]Benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one, 3,4-dihydro-9-hydroxy-;4-Hydroxy-8,14-dithia-11-azatricyclo[7.5.0.0^{2,7}]tetradeca-1(9),2,4,6-tetraen-10-one;inhibit,kb NB 142-70,Inhibitor,kb NB 14270,PKD,Protein kinase D,kb NB 142 70;9-Hydroxy-3,4-dihydrobenzo[4,5]thieno[2,3-f][1,4]thiazepin-5(2H)-one | | CAS: | 1233533-04-4 | | MF: | C11H9NO2S2 | | MW: | 251.32 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 1233533-04-4.mol | ![3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one Structure](CAS/GIF/1233533-04-4.gif) |
| | 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one Chemical Properties |
| Melting point | 235-238℃ (decomposition) (water dichloromethane ) | | Boiling point | 601.9±55.0 °C(Predicted) | | density | 1.495±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble10mg/mL, clear | | form | powder | | pka | 8.99±0.20(Predicted) | | color | white to beige | | InChI | 1S/C11H9NO2S2/c13-6-1-2-8-7(5-6)9-10(16-8)11(14)12-3-4-15-9/h1-2,5,13H,3-4H2,(H,12,14) | | InChIKey | DHUAGGSHTKPOHU-UHFFFAOYSA-N | | SMILES | Oc1ccc2sc3C(=O)NCCSc3c2c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one Usage And Synthesis |
| Uses | kb NB 142-70 is a potent & selective protein kinase D inhibitor. | | Biological Activity | kb-NB142-70 is a derivative of the PKD1 inhibitor CID755673, with approximately 6-fold greater potency (IC50 for inhibition of PKD1 = 28.3 nM vs. 182 nM for CID755673). kb-NB142-70 dose dependently inhibits proliferation of PC3 prostate cancer cell, and blocks migration of the prostate cancer lines PC3 and DU145. | | IC 50 | PKD1: 28.3 nM (IC50); PKD3: 53.2 nM (IC50); PKD2: 58.7 nM (IC50) | | storage | Store at RT |
| | 3,4-Dihydro-9-hydroxy-[1]benzothieno[2,3-f]-1,4-thiazepin-5(2H)-one Preparation Products And Raw materials |
|