|
|
| | Diisobutylthiuram disulfide Basic information | | Uses |
| Product Name: | Diisobutylthiuram disulfide | | Synonyms: | tetra(isobutyl)thioperoxydicarbamic acid;TETRA-ISO-BUTYL THIURAM DISULFIDE;Diisobutylthiuram disulfide;ISOBUTYL TUADS;DiisobutylThiuramDisulfide(Tibtd);Thioperoxydicarbonic diamide ((H2N)C(S)2S2), tetrakis(2-methylpropyl)-;1,1'-Dithiobis(N,N-diisobutylthioformamide);Bis(diisobutylthiocarbamoyl) persulfide | | CAS: | 3064-73-1 | | MF: | C18H36N2S4 | | MW: | 408.75 | | EINECS: | 221-312-5 | | Product Categories: | | | Mol File: | 3064-73-1.mol |  |
| | Diisobutylthiuram disulfide Chemical Properties |
| Melting point | 73.5-74.5 °C | | Boiling point | 462.9±28.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | pka | 0.90±0.50(Predicted) | | Water Solubility | 48.8μg/L at 20℃ | | InChI | InChI=1S/C10H20N2S4/c1-7(2)5-12(6-8(3)4)10(14)16-15-9(11)13/h7-8H,5-6H2,1-4H3,(H2,11,13) | | InChIKey | LONUOYOIXHJUFL-UHFFFAOYSA-N | | SMILES | N(CC(C)C)(CC(C)C)C(SSC(N)=S)=S | | LogP | 7.3 | | EPA Substance Registry System | Thioperoxydicarbonic diamide ([(H2N)C(S)]2S2), tetrakis(2-methylpropyl)- (3064-73-1) |
| | Diisobutylthiuram disulfide Usage And Synthesis |
| Uses | Isobutyl Thiuram Disulfide is an effective curing agent for acrylonitrile-butadiene rubber (NBR) only in the presence of ZnO and stearic acid as curing activators. Also, it is derived from Diisobutylamine (D446538), which is a reagent used in organic synthesis including the preparation of bx7 inhibitors which may be useful in the treatment of certain cancers. | | Uses | Isobutyl Thiuram Disulfide is an effective curing agent for acrylonitrile-butadiene rubber (NBR) only in the presence of ZnO and stearic acid as curing activators.Also, it is derived from Diisobutylamine (D446538), which is a reagent used in organic synthesis including the preparation of bx7 inhibitors which may be useful in the treatment of certain cancers. | | Flammability and Explosibility | Not classified |
| | Diisobutylthiuram disulfide Preparation Products And Raw materials |
|