- 4,4'-Trimethylenedipyridine
-
- $5.00 / 1kg
-
2025-09-25
- CAS:17252-51-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4,4'-Trimethylenedipyridine Basic information |
| Product Name: | 4,4'-Trimethylenedipyridine | | Synonyms: | 1,3-di(pyridin-4-yl)propane;4,4'-TRIMETHYLENEDIPYRIDINE LABOTEST-BB LT00451956;4,4’-(1,3-propanediyl)bis-pyridin;4,4'-TriMethylenedipyridine 98%;4,4’-(1,3-propanediyl)bis-Pyridine;1,3-DI-4-PYRIDINOPROPANE;1,3-DI(4-PYRIDYL)PROPANE;LABOTEST-BB LT00451956 | | CAS: | 17252-51-6 | | MF: | C13H14N2 | | MW: | 198.26 | | EINECS: | 241-284-8 | | Product Categories: | Achiral Nitrogen;Py-N;Chemical Synthesis;Heterocyclic Building Blocks;C9 to C46;Heterocyclic Building Blocks;Pyridines;C13 to C15;Building Blocks | | Mol File: | 17252-51-6.mol |  |
| | 4,4'-Trimethylenedipyridine Chemical Properties |
| Melting point | 57-60 °C(lit.) | | Boiling point | 142°C 2mm | | density | 1.066±0.06 g/cm3(Predicted) | | Fp | 142°C/2mm | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Slightly soluble in water | | pka | 6.30±0.10(Predicted) | | form | crystal | | color | light yellow | | Sensitive | Hygroscopic | | BRN | 150231 | | InChI | InChI=1S/C13H14N2/c1(2-12-4-8-14-9-5-12)3-13-6-10-15-11-7-13/h4-11H,1-3H2 | | InChIKey | OGNCVVRIKNGJHQ-UHFFFAOYSA-N | | SMILES | C(C1C=CN=CC=1)CCC1C=CN=CC=1 | | CAS DataBase Reference | 17252-51-6(CAS DataBase Reference) | | EPA Substance Registry System | Pyridine, 4,4'-(1,3-propanediyl)bis- (17252-51-6) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-28-36/37/39-45 | | RIDADR | 2811 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,4'-Trimethylenedipyridine Usage And Synthesis |
| Chemical Properties | Light yellow crystal | | Uses | 4,4′-Trimethylenedipyridine was used as ligand to study the solvent effects on the formal potential of redox-active self-assembling system [Os(bpy)2(dipy)Cl]1+ (bpy= 2,2′-bipyridine, dipy= 4,4′-Trimethylenedipyridine) in different organic solvents and aqueous solutions. It was used in the synthesis of two- and three-dimensional cadmium-organic frameworks. | | Solubility in organics | Soluble in Methanol | | Purification Methods | Crystallise the propane from n-hexane/*benzene (5:1) or Me2CO. The picrate has m 185-185o.[Jampolsky et al. J Am Chem Soc 74 5222 1952, Chow & Fouss J Am Chem Soc 80 1095 1958, Beilstein 23 III/IV 1400.] |
| | 4,4'-Trimethylenedipyridine Preparation Products And Raw materials |
|