|
|
| | S-(3-Carboxypropyl)-L-cysteine Basic information |
| | S-(3-Carboxypropyl)-L-cysteine Chemical Properties |
| Melting point | >207°C (dec.) | | Boiling point | 453.1±45.0 °C(Predicted) | | density | 1.369±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly) | | pka | 2.09±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | 2mg/mL, clear (0.1N HCl
Warmed) | | InChI | 1S/C7H13NO4S/c8-5(7(11)12)4-13-3-1-2-6(9)10/h5H,1-4,8H2,(H,9,10)(H,11,12)/t5-/m0/s1 | | InChIKey | WNFNRNDFHINZLV-YFKPBYRVSA-N | | SMILES | S(C[C@H](N)C(=O)O)CCCC(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | S-(3-Carboxypropyl)-L-cysteine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | S-(3-Carboxypropyl)-L-cysteine is a thioether derivative of L-cysteine. | | Biological Activity | S-3-Carboxypropyl-L-cysteine is a potent and selective reversible inhibitor of Cystathionine γ-lyase th at inhibits both the cystathionine and cysteine cleavage reactions. S-3-Carboxypropyl-L-cysteine inhibits the transsulfuration pathway and H2S production in cells. It does not inhibit cystathionine β-synthase and mercaptopyruvate sulfurtransferase. |
| | S-(3-Carboxypropyl)-L-cysteine Preparation Products And Raw materials |
|