| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Methyl 3-aMino-4-(trifluoroMethyl)benzoate Basic information |
| Product Name: | Methyl 3-aMino-4-(trifluoroMethyl)benzoate | | Synonyms: | Methyl 3-aMino-4-(trifluoroMethyl)benzoate;3-Amino-4-(trifluormethyl)benzoesaeure-methylester;3-Amino-4-trifluoromethyl-benzoic acid methyl ester;Benzoic acid, 3-amino-4-(trifluoromethyl)-, methyl ester | | CAS: | 126541-82-0 | | MF: | C9H8F3NO2 | | MW: | 219.16 | | EINECS: | | | Product Categories: | | | Mol File: | 126541-82-0.mol |  |
| | Methyl 3-aMino-4-(trifluoroMethyl)benzoate Chemical Properties |
| Boiling point | 294.1±40.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 0.32±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C9H8F3NO2/c1-15-8(14)5-2-3-6(7(13)4-5)9(10,11)12/h2-4H,13H2,1H3 | | InChIKey | GESWYDYJQMSAOJ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(C(F)(F)F)C(N)=C1 |
| | Methyl 3-aMino-4-(trifluoroMethyl)benzoate Usage And Synthesis |
| References | [1] Liebigs Annalen der Chemie, 1990, # 6, p. 569 - 579
[2] Patent: WO2015/143653, 2015, A1. Location in patent: Page/Page column 57
[3] Patent: WO2015/148344, 2015, A2. Location in patent: Page/Page column 104
[4] Patent: WO2015/143652, 2015, A1. Location in patent: Page/Page column 47
[5] Patent: WO2016/161572, 2016, A1. Location in patent: Page/Page column 75 |
| | Methyl 3-aMino-4-(trifluoroMethyl)benzoate Preparation Products And Raw materials |
|