- BMN 673 (8R,9S)
-
- $1.00
-
2019-07-06
- CAS:1207456-00-5
- Min. Order: 1G
- Purity: 98%
- Supply Ability: 100KG
|
| | BMN 673 (8R,9S) Basic information |
| Product Name: | BMN 673 (8R,9S) | | Synonyms: | (8R,9S)-BMN-673;(8R,9S)-5-Fluoro-8-(4-fluorophenyl)-2,7,8,9-tetrahydro-9-(1-methyl-1H-1,2,4-triazol-5-yl)-3H-pyrido[4,3,2-de]phthalazin-3-one;BMN 673 (8R,9S);BMN673 (8R,9S);BMN-673 (8R,9S);(8R,9S)-5-fluoro-8-(4-fluorophenyl)-9-(1-Methyl-1H-1,2,4-triazol-5-yl)-8,9-dihydro-2H-pyrido[4,3,2-de]phthalazin-3(7H)-one;(8R,9S)-5-Fluoro-8-(4-fluorophenyl)-2,7,8,9-tetrahydro-9-(1-Methyl-1H-1,2,4-triazol-5-yl)-3H-pyrido[4,3,2-de]phthalazine-3-one;3H-Pyrido[4,3,2-de]phthalazin-3-one, 5-fluoro-8-(4-fluorophenyl)-2,7,8,9-tetrahydro-9-(1-methyl-1H-1,2,4-triazol-5-yl)-, (8R,9S)- | | CAS: | 1207456-00-5 | | MF: | C19H14F2N6O | | MW: | 380.35 | | EINECS: | | | Product Categories: | API | | Mol File: | 1207456-00-5.mol |  |
| | BMN 673 (8R,9S) Chemical Properties |
| density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | ≥38 mg/mL in DMSO with gentle warming; insoluble in H2O; ≥15.03 mg/mL in EtOH with gentle warming and ultrasonic | | form | solid | | pka | 10.14±0.60(Predicted) | | color | White to off-white | | InChI | InChI=1S/C19H14F2N6O/c1-27-18(22-8-23-27)15-16(9-2-4-10(20)5-3-9)24-13-7-11(21)6-12-14(13)17(15)25-26-19(12)28/h2-8,15-16,24H,1H3,(H,26,28)/t15-,16-/m0/s1 | | InChIKey | HWGQMRYQVZSGDQ-HOTGVXAUSA-N | | SMILES | C1(=O)C2=C3C(N[C@@H](C4=CC=C(F)C=C4)[C@H](C4N(C)N=CN=4)C3=NN1)=CC(F)=C2 |
| | BMN 673 (8R,9S) Usage And Synthesis |
| Uses | (8R,9S)-Talazoparib ((8R,9S)-BMN-673) is an enantiomer of Talazoparib. (8R,9S)-Talazoparib is an PARP1 inhibitor, with an IC50 of 144 nM[1]. | | IC 50 | PARP-1: 144 nM (IC50) | | References | [1] Wang B, et al. Discovery and Characterization of (8S,9R)-5-Fluoro-8-(4-fluorophenyl)-9-(1-methyl-1H-1,2,4-triazol-5-yl)-2,7,8,9-tetrahydro-3H-pyrido[4,3,2-de]phthalazin-3-one (BMN 673, Talazoparib), a Novel, Highly Potent, and Orally Efficacious Poly(ADP- DOI:10.1021/acs.jmedchem.5b01498 |
| | BMN 673 (8R,9S) Preparation Products And Raw materials |
|