|
|
| | EthoxycarbonylMethylzinc broMide Basic information |
| Product Name: | EthoxycarbonylMethylzinc broMide | | Synonyms: | Acetic acid ethyl ester,
zinc coMplex;CarbethoxyMethyl zinc broMide;EthoxycarbonylMethylzinc broMide;bromo(2-ethoxy-2-oxoethyl)zinc;2-Ethoxy-2-oxoethylzinc bromide, 0.50 M in Ether;BRZNCH2CO2ET;EthyBromozincacetate;brobromozinc(1+),ethyl acetatemozinc(1+),ethyl acetate | | CAS: | 5764-82-9 | | MF: | C4H7BrO2Zn | | MW: | 232.38 | | EINECS: | | | Product Categories: | | | Mol File: | 5764-82-9.mol |  |
| | EthoxycarbonylMethylzinc broMide Chemical Properties |
| InChI | InChI=1S/C4H7O2.BrH.Zn/c1-3-6-4(2)5;;/h2-3H2,1H3;1H;/q;;+1/p-1 | | InChIKey | JRTBZDWNNONAGI-UHFFFAOYSA-M | | SMILES | C(=O)(OCC)C[Zn]Br |
| | EthoxycarbonylMethylzinc broMide Usage And Synthesis |
| Uses | EthoxycarbonylMethylzinc broMide is used as a chemoselective ester enolate reagent.
| | storage | EthoxycarbonylMethylzinc broMide is prone to hydrolysis and must be handled in anhydrous solvents under an inert atmosphere.
|
| | EthoxycarbonylMethylzinc broMide Preparation Products And Raw materials |
|