- H-ASN-OTBU
-
- $100.00 / 1KG
-
2019-07-06
- CAS:63094-81-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | H-ASN-OTBU Basic information |
| | H-ASN-OTBU Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | Powder | | color | White | | Optical Rotation | [α]/D +11.5±1.0°, c = 1 in methanol | | BRN | 6585123 | | Major Application | peptide synthesis | | InChI | 1S/C8H16N2O3.ClH/c1-8(2,3)13-7(12)5(9)4-6(10)11;/h5H,4,9H2,1-3H3,(H2,10,11);1H/t5-;/m0./s1 | | InChIKey | RXNKCUXXNGWROA-JEDNCBNOSA-N | | SMILES | Cl.CC(C)(C)OC(=O)[C@@H](N)CC(N)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-ASN-OTBU Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | L-Asparagine tert-butyl ester hydrochloride may be used as a starting material in the multi-step synthesis of L-aspartyl-L-asparagine. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-ASN-OTBU Preparation Products And Raw materials |
|