|
|
| | Loxoprofen Ring-opening IMpurity Basic information |
| Product Name: | Loxoprofen Ring-opening IMpurity | | Synonyms: | Loxoprofen Ring-opening IMpurity;Loxoprofen Impurity K;Loxoprofen Impurity 12;Bendamustine Impurity: 6-[4-(1-Carboxy-ethyl)-phenyl]-5-oxo-hexanoic acid;4-(1-Carboxyethyl)-δ-oxo-benzenehexanoic Acid;Benzenehexanoic acid, 4-(1-carboxyethyl)-δ-oxo-;Loxoprofen sodium degrades impurity B;4-(1-Carboxyethyl)-d-oxo-benzenehexanoic Acid | | CAS: | 1091621-61-2 | | MF: | C15H18O5 | | MW: | 278.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1091621-61-2.mol |  |
| | Loxoprofen Ring-opening IMpurity Chemical Properties |
| Boiling point | 504.8±35.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | pka | 4.32±0.10(Predicted) | | InChI | InChI=1S/C15H18O5/c1-10(15(19)20)12-7-5-11(6-8-12)9-13(16)3-2-4-14(17)18/h5-8,10H,2-4,9H2,1H3,(H,17,18)(H,19,20) | | InChIKey | ALZUIVGLLMTAMW-UHFFFAOYSA-N | | SMILES | C(C1C=CC(=CC=1)CC(=O)CCCC(=O)O)(C)C(=O)O |
| | Loxoprofen Ring-opening IMpurity Usage And Synthesis |
| Uses | 4-(1-Carboxyethyl)-δ-oxo-benzenehexanoic Acid is a degradation product of Loxoprofen (L472900, Na salt), a non-selective nonsteroidal anti-inflammatory drug (NSAID) that has been effective in reducing atherosclerosis in mice by reducing inflammation. It becomes active after metabolism in the body and inhibits the activation of cyclooxygenase. |
| | Loxoprofen Ring-opening IMpurity Preparation Products And Raw materials |
|