|
|
| | (+/-)-TRANS-EPOXYSUCCINIC ACID Basic information |
| | (+/-)-TRANS-EPOXYSUCCINIC ACID Chemical Properties |
| Melting point | 210-216°C | | Boiling point | 467.5±45.0 °C(Predicted) | | density | 1.920±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Water Solubility | Soluble in water | | form | powder to crystal | | pka | 2.84±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2-/s3 | | InChIKey | DCEMCPAKSGRHCN-DLDCVFTPNA-N | | SMILES | O1[C@@H](C(O)=O)[C@@H]1C(O)=O |&1:1,5,r| |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2917.20.0000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+/-)-TRANS-EPOXYSUCCINIC ACID Usage And Synthesis |
| Definition | ChEBI: Trans-2,3-epoxysuccinic acid is the trans-2,3-epoxy derivative of succinic acid. It is an epoxide and a C4-dicarboxylic acid. It is functionally related to a succinic acid. It is a conjugate acid of a trans-2,3-epoxysuccinate(2-). |
| | (+/-)-TRANS-EPOXYSUCCINIC ACID Preparation Products And Raw materials |
|