| Company Name: |
SHAANXI DIDEU MEDICHEM CO.LTD
|
| Tel: |
029-029-81123119 17391733320 |
| Email: |
1021@dideu.com |
| Products Intro: |
Product Name:4-(1,1,2,2,2-pentafluoroethyl)benzonitrile CAS:128273-61-0 Purity:95% Package:25KG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:4-(Pentafluoroethyl)benzonitrile
|
| Company Name: |
CHEMSWORTH
|
| Tel: |
+91-261-2397244 |
| Email: |
info@chemsworth.com |
| Products Intro: |
Product Name:4-(Pentafluoroethyl)benzonitrile CAS:128273-61-0
|
| Company Name: |
Apollo Scientific Ltd.
|
| Tel: |
44 161 406 0505 |
| Email: |
sales@apolloscientific.co.uk |
| Products Intro: |
Product Name:4-(Pentafluoroethyl)benzonitrile CAS:128273-61-0
|
|
| | 4-(Pentafluoroethyl)benzonitrile Basic information |
| | 4-(Pentafluoroethyl)benzonitrile Chemical Properties |
| Boiling point | 198.5±40.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | form | solid | | color | white | | InChI | 1S/C9H4F5N/c10-8(11,9(12,13)14)7-3-1-6(5-15)2-4-7/h1-4H | | InChIKey | RTEHQGJAXQGXIW-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C1=CC=C(C#N)C=C1 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | No | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-(Pentafluoroethyl)benzonitrile Usage And Synthesis |
| | 4-(Pentafluoroethyl)benzonitrile Preparation Products And Raw materials |
|